Attributes
UniProt ID
Protein Name
Kanamycin nucleotidyltransferase
Ligand Name
NEOMYCIN
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PGBHMTALBVVCIT-VCIWKGPPSA-N
SMILES
C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)N)OC3C(C(C(O3)CO)OC4C(C(C(C(O4)CN)O)O)N)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6NMK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6nmkA1e6nmkA2e6nmkB1e6nmkB2
ECOD domains from experimental PDB structures interacting with ligand DB00452
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q57514 | DB00452 | NMY | 6nmk | e6nmkA1 | A:2-125 |
| Q57514 | DB00452 | NMY | 6nmk | e6nmkA2 | A:126-253 |
| Q57514 | DB00452 | NMY | 6nmk | e6nmkB1 | B:1-125 |
| Q57514 | DB00452 | NMY | 6nmk | e6nmkB2 | B:126-253 |
| Q57514 | DB00452 | NMY | 6nml | e6nmlA1 | A:1-125 |
| Q57514 | DB00452 | NMY | 6nml | e6nmlA2 | A:126-253 |
| Q57514 | DB00452 | NMY | 6nml | e6nmlB1 | B:126-253 |
| Q57514 | DB00452 | NMY | 6nml | e6nmlB2 | B:2-125 |
| Q57514 | DB00452 | NMY | 6nmm | e6nmmA1 | A:2-125 |
| Q57514 | DB00452 | NMY | 6nmm | e6nmmA2 | A:126-253 |
| Q57514 | DB00452 | NMY | 6nmm | e6nmmB1 | B:2-125 |
| Q57514 | DB00452 | NMY | 6nmm | e6nmmC1 | C:126-253 |
| Q57514 | DB00452 | NMY | 6nmm | e6nmmC2 | C:2-125 |
| Q57514 | DB00452 | NMY | 6nmm | e6nmmD1 | D:2-125 |
| Q57514 | DB00452 | NMY | 6nmn | e6nmnA1 | A:126-253 |
| Q57514 | DB00452 | NMY | 6nmn | e6nmnA2 | A:1-125 |
| Q57514 | DB00452 | NMY | 6nmn | e6nmnB1 | B:126-253 |
| Q57514 | DB00452 | NMY | 6nmn | e6nmnB2 | B:1-125 |