Attributes
UniProt ID
Protein Name
2-amino-3,7-dideoxy-D-threo-hept-6-ulosonate synthase
Ligand Name
1,6-DI-O-PHOSPHONO-D-ALLITOL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WOYYTQHMNDWRCW-FBXFSONDSA-N
SMILES
C(C(C(C(C(COP(=O)(O)O)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2QJG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2qjgA1e2qjgB1e2qjgC1e2qjgD1e2qjgE1e2qjgF1e2qjgG1e2qjgH1e2qjgI1e2qjgJ1e2qjgK1e2qjgL1e2qjgM1e2qjgN1e2qjgO1e2qjgP1e2qjgQ1e2qjgR1e2qjgS1e2qjgT1
ECOD domains from experimental PDB structures interacting with ligand DB02760
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q57843 | DB02760 | F2P | 2qjg | e2qjgA1 | A:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgB1 | B:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgC1 | C:3-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgD1 | D:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgE1 | E:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgF1 | F:2-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgG1 | G:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgH1 | H:1-271 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgI1 | I:2-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgJ1 | J:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgK1 | K:2-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgL1 | L:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgM1 | M:1-271 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgN1 | N:1-271 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgO1 | O:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgP1 | P:2-271 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgQ1 | Q:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgR1 | R:1-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgS1 | S:2-272 |
| Q57843 | DB02760 | F2P | 2qjg | e2qjgT1 | T:2-272 |