Attributes
UniProt ID
Protein Name
FXYD domain-containing ion transport regulator
Ligand Name
1,2-DIOLEOYL-SN-GLYCERO-3-PHOSPHOCHOLINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SNKAWJBJQDLSFF-NVKMUCNASA-O
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7D93
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7d93A1e7d93A2e7d93A3e7d93A4e7d93B1e7d93B2e7d93C1e7d93C2e7d93C3e7d93C4e7d93D1e7d93D2e7d93E1e7d93G1
ECOD domains from experimental PDB structures interacting with ligand DB03690
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q58K79 | DB03690 | PCW | 7d93 | e7d93E1 | E:17-48 |
| Q58K79 | DB03690 | PCW | 7d94 | e7d94E1 | E:17-48 |
| Q58K79 | DB03690 | PCW | 7d94 | e7d94G1 | G:17-48 |
| Q58K79 | DB03690 | PCW | 7ddf | e7ddfE1 | E:17-48 |
| Q58K79 | DB03690 | PCW | 7ddf | e7ddfG1 | G:17-48 |
| Q58K79 | DB03690 | PCW | 7ddh | e7ddhE1 | E:17-48 |
| Q58K79 | DB03690 | PCW | 7ddh | e7ddhG1 | G:17-48 |
| Q58K79 | DB03690 | PCW | 7ddi | e7ddiG1 | G:17-48 |
| Q58K79 | DB03690 | PCW | 7ddk | e7ddkE1 | E:17-48 |
| Q58K79 | DB03690 | PCW | 7ddk | e7ddkG1 | G:17-48 |
| Q58K79 | DB03690 | PCW | 7ddl | e7ddlE1 | E:17-48 |
| Q58K79 | DB03690 | PCW | 7ddl | e7ddlG1 | G:17-48 |
| Q58K79 | DB03690 | PCW | 7wys | e7wysE1 | E:17-48 |
| Q58K79 | DB03690 | PCW | 7wys | e7wysG1 | G:17-48 |
| Q58K79 | DB03690 | PCW | 7wyt | e7wytE1 | E:17-48 |
| Q58K79 | DB03690 | PCW | 7wyt | e7wytG1 | G:17-48 |
| Q58K79 | DB03690 | PCW | 8jbk | e8jbkE1 | E:16-48 |
| Q58K79 | DB03690 | PCW | 8jbl | e8jblE1 | E:16-48 |
| Q58K79 | DB03690 | PCW | 8jbl | e8jblG1 | G:17-51 |
| Q58K79 | DB03690 | PCW | 8jbm | e8jbmE1 | E:16-48 |
| Q58K79 | DB03690 | PCW | 8jbm | e8jbmG1 | G:17-51 |