Attributes
UniProt ID
Protein Name
DNA polymerase I
Ligand Name
2',3'-DIDEOXY-THYMIDINE-5'-TRIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
URGJWIFLBWJRMF-JGVFFNPUSA-N
SMILES
CC1=CN(C(=O)NC1=O)C2CCC(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2HHW
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2hhwA1e2hhwA2e2hhwA3e2hhwA4e2hhwD1e2hhwD2e2hhwD3e2hhwD4
ECOD domains from experimental PDB structures interacting with ligand D3T
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5KWC1 | n/a | D3T | 2hhw | e2hhwA1 | A:668-791 |
| Q5KWC1 | n/a | D3T | 2hhw | e2hhwA2 | A:469-642 |
| Q5KWC1 | n/a | D3T | 2hhw | e2hhwA3 | A:643-667,A:792-875 |
| Q5KWC1 | n/a | D3T | 2hhw | e2hhwD1 | D:668-791 |
| Q5KWC1 | n/a | D3T | 2hhw | e2hhwD2 | D:469-642 |
| Q5KWC1 | n/a | D3T | 2hhw | e2hhwD3 | D:643-667,D:792-875 |
| Q5KWC1 | n/a | D3T | 3hp6 | e3hp6A1 | A:668-791 |
| Q5KWC1 | n/a | D3T | 3hp6 | e3hp6A2 | A:469-642 |
| Q5KWC1 | n/a | D3T | 3hp6 | e3hp6A3 | A:643-667,A:792-876 |
| Q5KWC1 | n/a | D3T | 3hp6 | e3hp6D1 | D:668-791 |
| Q5KWC1 | n/a | D3T | 3hp6 | e3hp6D2 | D:469-642 |
| Q5KWC1 | n/a | D3T | 3hp6 | e3hp6D3 | D:643-667,D:792-876 |
| Q5KWC1 | n/a | D3T | 3pv8 | e3pv8A1 | A:668-791 |
| Q5KWC1 | n/a | D3T | 3pv8 | e3pv8A2 | A:469-642 |
| Q5KWC1 | n/a | D3T | 3pv8 | e3pv8A3 | A:643-667,A:792-876 |
| Q5KWC1 | n/a | D3T | 3pv8 | e3pv8D1 | D:668-791 |
| Q5KWC1 | n/a | D3T | 3pv8 | e3pv8D2 | D:469-642 |
| Q5KWC1 | n/a | D3T | 3pv8 | e3pv8D3 | D:643-667,D:792-876 |
| Q5KWC1 | n/a | D3T | 4ez9 | e4ez9D1 | D:668-791 |
| Q5KWC1 | n/a | D3T | 4ez9 | e4ez9D2 | D:469-642 |
| Q5KWC1 | n/a | D3T | 4ez9 | e4ez9D3 | D:643-667,D:792-876 |
| Q5KWC1 | n/a | D3T | 4f3o | e4f3oD1 | D:668-791 |
| Q5KWC1 | n/a | D3T | 4f3o | e4f3oD2 | D:469-642 |
| Q5KWC1 | n/a | D3T | 4f3o | e4f3oD3 | D:643-667,D:792-876 |