Attributes
UniProt ID
Protein Name
DNA polymerase I
Ligand Name
2'-DEOXYCYTIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGWHQCVHVJXOKC-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2HHU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2hhuA1e2hhuA2e2hhuA3e2hhuA4
ECOD domains from experimental PDB structures interacting with ligand DB03258
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5KWC1 | DB03258 | DCP | 2hhu | e2hhuA1 | A:668-791 |
| Q5KWC1 | DB03258 | DCP | 2hhu | e2hhuA2 | A:469-642 |
| Q5KWC1 | DB03258 | DCP | 3px0 | e3px0A1 | A:469-649 |
| Q5KWC1 | DB03258 | DCP | 3px0 | e3px0A2 | A:298-468 |
| Q5KWC1 | DB03258 | DCP | 3px0 | e3px0A3 | A:650-791 |
| Q5KWC1 | DB03258 | DCP | 3px0 | e3px0D1 | D:668-791 |
| Q5KWC1 | DB03258 | DCP | 3px0 | e3px0D2 | D:469-642 |
| Q5KWC1 | DB03258 | DCP | 3px0 | e3px0D3 | D:643-667,D:792-876 |
| Q5KWC1 | DB03258 | DCP | 4dqi | e4dqiA2 | A:298-468 |
| Q5KWC1 | DB03258 | DCP | 4dqi | e4dqiA6 | A:669-792 |
| Q5KWC1 | DB03258 | DCP | 4dqi | e4dqiA7 | A:469-643 |
| Q5KWC1 | DB03258 | DCP | 4dqi | e4dqiD11 | D:669-792 |
| Q5KWC1 | DB03258 | DCP | 4dqi | e4dqiD12 | D:469-643 |
| Q5KWC1 | DB03258 | DCP | 4dqi | e4dqiD9 | D:644-668,D:793-876 |
| Q5KWC1 | DB03258 | DCP | 4e0d | e4e0dA10 | A:297-468 |
| Q5KWC1 | DB03258 | DCP | 4e0d | e4e0dA11 | A:669-792 |
| Q5KWC1 | DB03258 | DCP | 4e0d | e4e0dA12 | A:469-643 |