Attributes
UniProt ID
Protein Name
Ferrous iron transport protein B
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3B1W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3b1wA3e3b1wA4e3b1wB3e3b1wB4e3b1wC3e3b1wC4e3b1wD3e3b1wD4
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5M586 | DB04315 | GDP | 3b1w | e3b1wA3 | A:0-169 |
| Q5M586 | DB04315 | GDP | 3b1w | e3b1wB3 | B:0-169 |
| Q5M586 | DB04315 | GDP | 3b1w | e3b1wC3 | C:1-169 |
| Q5M586 | DB04315 | GDP | 3b1w | e3b1wD3 | D:1-169 |
| Q5M586 | DB04315 | GDP | 3lx8 | e3lx8A3 | A:1-169 |
| Q5M586 | DB04315 | GDP | 3ss8 | e3ss8A1 | A:1-163 |
| Q5M586 | DB04315 | GDP | 3ss8 | e3ss8B1 | B:1-163 |
| Q5M586 | DB04315 | GDP | 4non | e4nonA2 | A:1-163 |
| Q5M586 | DB04315 | GDP | 4non | e4nonB2 | B:1-163 |
| Q5M586 | DB04315 | GDP | 7bvu | e7bvuA2 | A:1-169 |
| Q5M586 | DB04315 | GDP | 7bvu | e7bvuB2 | B:1-169 |
| Q5M586 | DB04315 | GDP | 7bwv | e7bwvA1 | A:1-169 |
| Q5M586 | DB04315 | GDP | 7bwv | e7bwvB2 | B:1-169 |