Attributes
UniProt ID
Protein Name
Large ribosomal subunit protein uL4
Ligand Name
ARGININE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ODKSFYDXXFIFQN-BYPYZUCNSA-O
SMILES
C(CC(C(=O)O)N)CNC(=[NH2+])N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4Y4O
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4y4o101e4y4o111e4y4o121e4y4o131e4y4o141e4y4o151e4y4o161e4y4o171e4y4o181e4y4o191e4y4o1D1e4y4o1D2e4y4o1E1e4y4o1F1e4y4o1G1e4y4o1H1e4y4o1H2e4y4o1I1e4y4o1I2e4y4o1N1e4y4o1O1e4y4o1P1e4y4o1Q1e4y4o1R1e4y4o1S1e4y4o1T1e4y4o1U1e4y4o1V1e4y4o1W1e4y4o1X1e4y4o1Y1e4y4o1Z1e4y4o1Z2e4y4o1b1e4y4o1c1e4y4o1c2e4y4o1d1e4y4o1e1e4y4o1e2e4y4o1f1e4y4o1g1e4y4o1h1e4y4o1h2e4y4o1i1e4y4o1j1e4y4o1k1e4y4o1l1e4y4o1m1e4y4o1n1e4y4o1o1e4y4o1p1e4y4o1q1e4y4o1r1e4y4o1s1e4y4o1t1e4y4o1y1e4y4o201e4y4o211e4y4o221e4y4o231e4y4o241e4y4o251e4y4o261e4y4o271e4y4o281e4y4o291e4y4o2D1e4y4o2D2e4y4o2E1e4y4o2F1e4y4o2G1e4y4o2H1e4y4o2H2e4y4o2I1e4y4o2I2e4y4o2N1e4y4o2O1e4y4o2P1e4y4o2Q1e4y4o2R1e4y4o2S1e4y4o2T1e4y4o2U1e4y4o2V1e4y4o2W1e4y4o2X1e4y4o2Y1e4y4o2Z1e4y4o2Z2e4y4o2b1e4y4o2c1e4y4o2c2e4y4o2d1e4y4o2e1e4y4o2e2e4y4o2f1e4y4o2g1e4y4o2h1e4y4o2h2e4y4o2i1e4y4o2j1e4y4o2k1e4y4o2l1e4y4o2m1e4y4o2n1e4y4o2o1e4y4o2p1e4y4o2q1e4y4o2r1e4y4o2s1e4y4o2t1e4y4o2y1
ECOD domains from experimental PDB structures interacting with ligand DB00125
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5SHN9 | DB00125 | ARG | 4y4o | e4y4o1F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 5v8i | e5v8i1F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 6cfk | e6cfk1F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 6cfl | e6cfl1F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 6xhx | e6xhx1F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 7md7 | e7md71F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 7rqa | e7rqa1F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 7rqb | e7rqb1F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 7rqc | e7rqc1F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 8fc1 | e8fc11F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 8fc2 | e8fc21F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 8fc3 | e8fc31F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 8fc4 | e8fc41F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 8fc5 | e8fc51F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 8fc6 | e8fc61F1 | 1F:6-208 |
| Q5SHN9 | DB00125 | ARG | 8t8b | e8t8b1F1 | 1F:6-208 |