Attributes
UniProt ID
Protein Name
D-alanine--D-alanine ligase
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2ZDG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2zdgA1e2zdgA2e2zdgB1e2zdgB2e2zdgC1e2zdgC2e2zdgD1e2zdgD2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5SHZ3 | DB16833 | ADP | 2zdg | e2zdgA1 | A:115-319 |
| Q5SHZ3 | DB16833 | ADP | 2zdg | e2zdgB1 | B:115-319 |
| Q5SHZ3 | DB16833 | ADP | 2zdg | e2zdgC1 | C:115-319 |
| Q5SHZ3 | DB16833 | ADP | 2zdg | e2zdgD1 | D:115-319 |
| Q5SHZ3 | DB16833 | ADP | 2zdh | e2zdhA1 | A:115-319 |
| Q5SHZ3 | DB16833 | ADP | 2zdh | e2zdhB1 | B:115-319 |
| Q5SHZ3 | DB16833 | ADP | 2zdh | e2zdhC1 | C:115-319 |
| Q5SHZ3 | DB16833 | ADP | 2zdh | e2zdhD1 | D:115-319 |
| Q5SHZ3 | DB16833 | ADP | 6u1h | e6u1hA1 | A:115-324 |
| Q5SHZ3 | DB16833 | ADP | 6u1h | e6u1hB1 | B:115-321 |
| Q5SHZ3 | DB16833 | ADP | 6u1h | e6u1hC1 | C:115-322 |
| Q5SHZ3 | DB16833 | ADP | 6u1h | e6u1hD2 | D:115-324 |
| Q5SHZ3 | DB16833 | ADP | 6u1i | e6u1iA2 | A:115-324 |
| Q5SHZ3 | DB16833 | ADP | 6u1i | e6u1iC1 | C:115-324 |
| Q5SHZ3 | DB16833 | ADP | 6u1j | e6u1jA1 | A:115-324 |
| Q5SHZ3 | DB16833 | ADP | 6u1j | e6u1jC1 | C:115-324 |
| Q5SHZ3 | DB16833 | ADP | 6u1k | e6u1kA2 | A:115-324 |
| Q5SHZ3 | DB16833 | ADP | 6u1k | e6u1kB2 | B:115-322 |
| Q5SHZ3 | DB16833 | ADP | 6u1k | e6u1kC1 | C:115-323 |
| Q5SHZ3 | DB16833 | ADP | 6u1k | e6u1kD2 | D:115-321 |