Attributes
UniProt ID
Protein Name
D-alanine--D-alanine ligase
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2ZDQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2zdqA1e2zdqA2e2zdqB1e2zdqB2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5SHZ3 | DB00171 | ATP | 2zdq | e2zdqA1 | A:115-319 |
| Q5SHZ3 | DB00171 | ATP | 2zdq | e2zdqB1 | B:115-319 |
| Q5SHZ3 | DB00171 | ATP | 6u1d | e6u1dA1 | A:115-322 |
| Q5SHZ3 | DB00171 | ATP | 6u1d | e6u1dA2 | A:-1-114 |
| Q5SHZ3 | DB00171 | ATP | 6u1d | e6u1dB1 | B:-1-114 |
| Q5SHZ3 | DB00171 | ATP | 6u1d | e6u1dB2 | B:115-324 |
| Q5SHZ3 | DB00171 | ATP | 6u1e | e6u1eA1 | A:0-114 |
| Q5SHZ3 | DB00171 | ATP | 6u1e | e6u1eA2 | A:115-323 |
| Q5SHZ3 | DB00171 | ATP | 6u1e | e6u1eB1 | B:115-324 |
| Q5SHZ3 | DB00171 | ATP | 6u1e | e6u1eB2 | B:-1-114 |
| Q5SHZ3 | DB00171 | ATP | 6u1f | e6u1fA1 | A:115-323 |
| Q5SHZ3 | DB00171 | ATP | 6u1f | e6u1fA2 | A:-1-114 |
| Q5SHZ3 | DB00171 | ATP | 6u1f | e6u1fB1 | B:115-323 |
| Q5SHZ3 | DB00171 | ATP | 6u1f | e6u1fB2 | B:-1-114 |
| Q5SHZ3 | DB00171 | ATP | 6u1g | e6u1gA1 | A:-1-114 |
| Q5SHZ3 | DB00171 | ATP | 6u1g | e6u1gA2 | A:115-324 |
| Q5SHZ3 | DB00171 | ATP | 6u1g | e6u1gB1 | B:-1-114 |
| Q5SHZ3 | DB00171 | ATP | 6u1g | e6u1gB2 | B:115-323 |