Attributes
UniProt ID
Protein Name
3-isopropylmalate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1HEX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1hexA1e1hexA2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5SIY4 | DB14128 | NAD | 1hex | e1hexA1 | A:1-99,A:252-345 |
| Q5SIY4 | DB14128 | NAD | 2y42 | e2y42A1 | A:0-99,A:252-346 |
| Q5SIY4 | DB14128 | NAD | 2y42 | e2y42B2 | B:1-99,B:252-350 |
| Q5SIY4 | DB14128 | NAD | 2y42 | e2y42C1 | C:0-99,C:252-351 |
| Q5SIY4 | DB14128 | NAD | 2y42 | e2y42D1 | D:0-99,D:252-354 |
| Q5SIY4 | DB14128 | NAD | 2ztw | e2ztwA2 | A:1-99,A:252-345 |
| Q5SIY4 | DB14128 | NAD | 4f7i | e4f7iA1 | A:100-251 |
| Q5SIY4 | DB14128 | NAD | 4f7i | e4f7iA2 | A:0-99,A:252-349 |
| Q5SIY4 | DB14128 | NAD | 4f7i | e4f7iB1 | B:100-251 |
| Q5SIY4 | DB14128 | NAD | 4f7i | e4f7iB2 | B:0-99,B:252-349 |
| Q5SIY4 | DB14128 | NAD | 4f7i | e4f7iC1 | C:100-251 |
| Q5SIY4 | DB14128 | NAD | 4f7i | e4f7iC2 | C:0-99,C:252-347 |
| Q5SIY4 | DB14128 | NAD | 4f7i | e4f7iD1 | D:100-251 |
| Q5SIY4 | DB14128 | NAD | 4f7i | e4f7iD2 | D:0-99,D:252-348 |
| Q5SIY4 | DB14128 | NAD | 4wuo | e4wuoA1 | A:100-251 |
| Q5SIY4 | DB14128 | NAD | 4wuo | e4wuoA2 | A:-1-99,A:252-347 |
| Q5SIY4 | DB14128 | NAD | 4wuo | e4wuoB1 | B:100-251 |
| Q5SIY4 | DB14128 | NAD | 4wuo | e4wuoB2 | B:1-99,B:252-345 |