Attributes
UniProt ID
Protein Name
Transcription termination factor Rho
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8HSJ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8hsjA1e8hsjA2e8hsjB1e8hsjB2e8hsjC1e8hsjC2e8hsjD1e8hsjD2e8hsjE1e8hsjE2e8hsjF1e8hsjF2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5SJE9 | DB16833 | ADP | 8hsj | e8hsjA2 | A:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsj | e8hsjB1 | B:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsj | e8hsjC1 | C:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsj | e8hsjD2 | D:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsj | e8hsjE2 | E:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsj | e8hsjF2 | F:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsl | e8hslA1 | A:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsl | e8hslB1 | B:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsl | e8hslC1 | C:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsl | e8hslD2 | D:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsl | e8hslE2 | E:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsl | e8hslF1 | F:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsr | e8hsrA1 | A:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsr | e8hsrB1 | B:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsr | e8hsrC1 | C:137-426 |
| Q5SJE9 | DB16833 | ADP | 8hsr | e8hsrD2 | D:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsr | e8hsrE2 | E:137-420 |
| Q5SJE9 | DB16833 | ADP | 8hsr | e8hsrF1 | F:137-420 |