Attributes
UniProt ID
Protein Name
Holliday junction branch migration complex subunit RuvB
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8EFV
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8efvA1e8efvA2e8efvA3e8efvB1e8efvB2e8efvB3e8efvC1e8efvC2e8efvC3e8efvD1e8efvD2e8efvD3e8efvE1e8efvE2e8efvE3e8efvF1e8efvF2e8efvF3
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5SL87 | DB16833 | ADP | 8efv | e8efvA1 | A:5-166 |
| Q5SL87 | DB16833 | ADP | 8efv | e8efvA3 | A:167-241 |
| Q5SL87 | DB16833 | ADP | 8efv | e8efvE2 | E:167-241 |
| Q5SL87 | DB16833 | ADP | 8efv | e8efvE3 | E:6-166 |
| Q5SL87 | DB16833 | ADP | 8efv | e8efvF1 | F:6-166 |
| Q5SL87 | DB16833 | ADP | 8efv | e8efvF2 | F:167-242 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyA2 | A:167-241 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyA3 | A:5-166 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyE1 | E:167-242 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyE3 | E:6-166 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyF1 | F:6-166 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyF3 | F:167-241 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyI2 | I:5-166 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyI3 | I:167-241 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyM2 | M:167-241 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyM3 | M:6-166 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyN1 | N:167-242 |
| Q5SL87 | DB16833 | ADP | 8efy | e8efyN3 | N:6-166 |