Attributes
UniProt ID
Protein Name
ABC transporter, periplasmic substrate-binding protein
Ligand Name
CITRIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES
C(C(=O)O)C(CC(=O)O)(C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6J9W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6j9wA1e6j9wA2
ECOD domains from experimental PDB structures interacting with ligand DB04272
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5SLD7 | DB04272 | CIT | 6j9w | e6j9wA1 | A:3-118,A:285-405 |
| Q5SLD7 | DB04272 | CIT | 6j9y | e6j9yA1 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jad | e6jadA1 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jag | e6jagA2 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jah | e6jahA2 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jai | e6jaiA2 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jam | e6jamA1 | A:1-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jan | e6janA2 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jao | e6jaoA1 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jap | e6japA2 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jaq | e6jaqA1 | A:3-118,A:285-405 |
| Q5SLD7 | DB04272 | CIT | 6jar | e6jarA1 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jaz | e6jazA2 | A:3-118,A:285-404 |
| Q5SLD7 | DB04272 | CIT | 6jb0 | e6jb0A1 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jb4 | e6jb4A1 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jba | e6jbaA1 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jbb | e6jbbA1 | A:3-118,A:285-406 |
| Q5SLD7 | DB04272 | CIT | 6jbe | e6jbeA1 | A:3-118,A:285-406 |