Attributes
UniProt ID
Protein Name
Cytochrome b-c1 complex subunit Rieske, mitochondrial
Ligand Name
1,2-dioleoyl-sn-glycero-3-phosphoethanolamine
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MWRBNPKJOOWZPW-NYVOMTAGSA-N
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3H1H
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3h1hA1e3h1hA2e3h1hB1e3h1hB2e3h1hC1e3h1hC2e3h1hD1e3h1hD2e3h1hE2e3h1hE3e3h1hF1e3h1hG1e3h1hH1e3h1hI1e3h1hJ1e3h1hN1e3h1hN2e3h1hO1e3h1hO2e3h1hP1e3h1hP2e3h1hQ1e3h1hQ2e3h1hR2e3h1hR3e3h1hS1e3h1hT1e3h1hU1e3h1hW1
ECOD domains from experimental PDB structures interacting with ligand DB04327
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5ZLR5 | DB04327 | PEE | 3h1h | e3h1hE2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3h1h | e3h1hR2 | R:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3h1i | e3h1iE2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3h1j | e3h1jE2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3h1j | e3h1jR2 | R:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3h1k | e3h1kE2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3h1k | e3h1kR2 | R:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3h1l | e3h1lE2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3h1l | e3h1lR2 | R:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3l70 | e3l70E2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3l70 | e3l70R2 | R:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3l72 | e3l72E2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3l72 | e3l72R2 | R:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3l73 | e3l73E2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3l73 | e3l73R2 | R:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3l74 | e3l74E2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3tgu | e3tguE2 | E:1-69 |
| Q5ZLR5 | DB04327 | PEE | 3tgu | e3tguR2 | R:1-69 |
| Q5ZLR5 | DB04327 | PEE | 4u3f | e4u3fE3 | E:1-66 |
| Q5ZLR5 | DB04327 | PEE | 4u3f | e4u3fR2 | R:1-69 |