Attributes
UniProt ID
Protein Name
Ectonucleoside triphosphate diphosphohydrolase I
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4BRA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4braA5e4braA6e4braB5e4braB6
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q5ZUA2 | DB03814 | MES | 4bra | e4braA5 | A:178-393 |
| Q5ZUA2 | DB03814 | MES | 4bra | e4braB5 | B:181-392 |
| Q5ZUA2 | DB03814 | MES | 4brc | e4brcA5 | A:175-396 |
| Q5ZUA2 | DB03814 | MES | 4brc | e4brcB5 | B:175-396 |
| Q5ZUA2 | DB03814 | MES | 4brd | e4brdA5 | A:175-392 |
| Q5ZUA2 | DB03814 | MES | 4brd | e4brdB5 | B:176-394 |
| Q5ZUA2 | DB03814 | MES | 4bre | e4breA5 | A:175-394 |
| Q5ZUA2 | DB03814 | MES | 4bre | e4breB5 | B:175-394 |
| Q5ZUA2 | DB03814 | MES | 4brf | e4brfA5 | A:175-394 |
| Q5ZUA2 | DB03814 | MES | 4brf | e4brfB5 | B:176-394 |
| Q5ZUA2 | DB03814 | MES | 4brg | e4brgA5 | A:178-392 |
| Q5ZUA2 | DB03814 | MES | 4brg | e4brgB5 | B:176-395 |
| Q5ZUA2 | DB03814 | MES | 4brh | e4brhA5 | A:175-394 |
| Q5ZUA2 | DB03814 | MES | 4brh | e4brhB5 | B:178-394 |
| Q5ZUA2 | DB03814 | MES | 4bri | e4briA5 | A:178-392 |
| Q5ZUA2 | DB03814 | MES | 4bri | e4briB5 | B:178-393 |
| Q5ZUA2 | DB03814 | MES | 4brk | e4brkA5 | A:175-394 |
| Q5ZUA2 | DB03814 | MES | 4brk | e4brkB5 | B:178-395 |
| Q5ZUA2 | DB03814 | MES | 4brq | e4brqA5 | A:175-395 |
| Q5ZUA2 | DB03814 | MES | 4brq | e4brqB5 | B:175-395 |
| Q5ZUA2 | DB03814 | MES | 4bvp | e4bvpA5 | A:175-401 |
| Q5ZUA2 | DB03814 | MES | 4bvp | e4bvpB1 | B:175-401 |