Attributes
UniProt ID
Protein Name
ATP-binding cassette sub-family C member 9
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7VLR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7vlrA1e7vlrA2e7vlrA3e7vlrA4
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q63563 | DB00171 | ATP | 7vlr | e7vlrA1 | A:1290-1545 |
| Q63563 | DB00171 | ATP | 7vlr | e7vlrA3 | A:250-327,A:347-612 |
| Q63563 | DB00171 | ATP | 7vlr | e7vlrA4 | A:611-612,A:665-912 |
| Q63563 | DB00171 | ATP | 7vls | e7vlsA1 | A:250-327,A:347-612 |
| Q63563 | DB00171 | ATP | 7vls | e7vlsA2 | A:1290-1545 |
| Q63563 | DB00171 | ATP | 7vls | e7vlsA3 | A:611-612,A:665-912 |
| Q63563 | DB00171 | ATP | 7vlt | e7vltA2 | A:611-612,A:665-912 |
| Q63563 | DB00171 | ATP | 7vlt | e7vltA3 | A:250-327,A:347-612 |
| Q63563 | DB00171 | ATP | 7vlt | e7vltA4 | A:1290-1545 |
| Q63563 | DB00171 | ATP | 7vlu | e7vluA1 | A:1290-1543 |
| Q63563 | DB00171 | ATP | 7vlu | e7vluA3 | A:611-612,A:665-912 |
| Q63563 | DB00171 | ATP | 7vlu | e7vluA4 | A:230-327,A:347-612 |
| Q63563 | DB00171 | ATP | 7y1k | e7y1kA3 | A:666-913 |
| Q63563 | DB00171 | ATP | 7y1k | e7y1kA4 | A:217-611 |
| Q63563 | DB00171 | ATP | 7y1m | e7y1mA1 | A:666-905 |
| Q63563 | DB00171 | ATP | 7y1m | e7y1mA4 | A:216-611 |
| Q63563 | DB00171 | ATP | 7y1n | e7y1nA1 | A:665-905 |
| Q63563 | DB00171 | ATP | 7y1n | e7y1nA4 | A:217-610 |