Attributes
UniProt ID
Protein Name
ATP-sensitive inward rectifier potassium channel 8 channel Kir6.1
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7MIT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7mitB1e7mitB2e7mitC1e7mitC2e7mitD1e7mitD2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q63664 | DB00171 | ATP | 7mit | e7mitB1 | B:30-51,B:184-366 |
| Q63664 | DB00171 | ATP | 7mit | e7mitC1 | C:30-51,C:184-365 |
| Q63664 | DB00171 | ATP | 7mit | e7mitD1 | D:30-51,D:184-366 |
| Q63664 | DB00171 | ATP | 7mit | e7mitD2 | D:52-185 |
| Q63664 | DB00171 | ATP | 7mjo | e7mjoA1 | A:183-368 |
| Q63664 | DB00171 | ATP | 7mjo | e7mjoC1 | C:31-51,C:184-367 |
| Q63664 | DB00171 | ATP | 7mjo | e7mjoD1 | D:30-51,D:184-366 |
| Q63664 | DB00171 | ATP | 7mjp | e7mjpB1 | B:30-51,B:184-367 |
| Q63664 | DB00171 | ATP | 7mjp | e7mjpC1 | C:30-51,C:184-368 |
| Q63664 | DB00171 | ATP | 7mjp | e7mjpD1 | D:30-51,D:184-368 |
| Q63664 | DB00171 | ATP | 7mjq | e7mjqA1 | A:23-185 |
| Q63664 | DB00171 | ATP | 7mjq | e7mjqA2 | A:183-368 |
| Q63664 | DB00171 | ATP | 7mjq | e7mjqB1 | B:30-51,B:184-366 |
| Q63664 | DB00171 | ATP | 7mjq | e7mjqC1 | C:30-51,C:184-367 |
| Q63664 | DB00171 | ATP | 7mjq | e7mjqD1 | D:184-366 |