Attributes
UniProt ID
Protein Name
Fiber
Ligand Name
N-acetyl-alpha-neuraminic acid
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SQVRNKJHWKZAKO-YRMXFSIDSA-N
SMILES
CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3QND
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3qndA1e3qndB1e3qndC1e3qndE1e3qndF1e3qndG1
ECOD domains from experimental PDB structures interacting with ligand DB03721
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q64823 | DB03721 | SIA | 3qnd | e3qndA1 | A:182-365 |
| Q64823 | DB03721 | SIA | 3qnd | e3qndB1 | B:181-365 |
| Q64823 | DB03721 | SIA | 3qnd | e3qndC1 | C:183-365 |
| Q64823 | DB03721 | SIA | 3qnd | e3qndE1 | E:182-365 |
| Q64823 | DB03721 | SIA | 3qnd | e3qndF1 | F:182-365 |
| Q64823 | DB03721 | SIA | 3qnd | e3qndG1 | G:182-365 |
| Q64823 | DB03721 | SIA | 4k6t | e4k6tA1 | A:180-365 |
| Q64823 | DB03721 | SIA | 4k6t | e4k6tB1 | B:180-365 |
| Q64823 | DB03721 | SIA | 4k6t | e4k6tC1 | C:184-365 |
| Q64823 | DB03721 | SIA | 4k6t | e4k6tE1 | E:181-365 |
| Q64823 | DB03721 | SIA | 4k6t | e4k6tF1 | F:180-365 |
| Q64823 | DB03721 | SIA | 4k6t | e4k6tG1 | G:181-365 |
| Q64823 | DB03721 | SIA | 4k6u | e4k6uA1 | A:182-365 |
| Q64823 | DB03721 | SIA | 4k6u | e4k6uB1 | B:179-365 |
| Q64823 | DB03721 | SIA | 4k6u | e4k6uC1 | C:183-365 |