Attributes
UniProt ID
Protein Name
deleted
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2EXH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2exhA1e2exhA2e2exhB1e2exhB2e2exhC1e2exhC2e2exhD1e2exhD2
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q68HB3 | DB03814 | MES | 2exh | e2exhA1 | A:325-534 |
| Q68HB3 | DB03814 | MES | 2exh | e2exhA2 | A:4-324 |
| Q68HB3 | DB03814 | MES | 2exh | e2exhB1 | B:325-534 |
| Q68HB3 | DB03814 | MES | 2exh | e2exhB2 | B:4-324 |
| Q68HB3 | DB03814 | MES | 2exh | e2exhD1 | D:325-534 |
| Q68HB3 | DB03814 | MES | 2exh | e2exhD2 | D:4-324 |
| Q68HB3 | DB03814 | MES | 2exi | e2exiA1 | A:325-534 |
| Q68HB3 | DB03814 | MES | 2exi | e2exiA2 | A:4-324 |
| Q68HB3 | DB03814 | MES | 2exi | e2exiB1 | B:325-534 |
| Q68HB3 | DB03814 | MES | 2exi | e2exiB2 | B:4-324 |
| Q68HB3 | DB03814 | MES | 2exi | e2exiD1 | D:325-534 |
| Q68HB3 | DB03814 | MES | 2exi | e2exiD2 | D:4-324 |
| Q68HB3 | DB03814 | MES | 2exj | e2exjA1 | A:325-534 |
| Q68HB3 | DB03814 | MES | 2exj | e2exjA2 | A:4-324 |
| Q68HB3 | DB03814 | MES | 2exj | e2exjB1 | B:325-534 |
| Q68HB3 | DB03814 | MES | 2exj | e2exjB2 | B:4-324 |
| Q68HB3 | DB03814 | MES | 2exj | e2exjD1 | D:325-534 |
| Q68HB3 | DB03814 | MES | 2exj | e2exjD2 | D:4-324 |
| Q68HB3 | DB03814 | MES | 2exk | e2exkA1 | A:325-534 |
| Q68HB3 | DB03814 | MES | 2exk | e2exkA2 | A:4-324 |
| Q68HB3 | DB03814 | MES | 2exk | e2exkB1 | B:325-534 |
| Q68HB3 | DB03814 | MES | 2exk | e2exkB2 | B:4-324 |
| Q68HB3 | DB03814 | MES | 2exk | e2exkD1 | D:325-534 |
| Q68HB3 | DB03814 | MES | 2exk | e2exkD2 | D:4-324 |