Attributes
UniProt ID
Protein Name
Neuraminidase
Ligand Name
(3R,4R,5S)-4-(acetylamino)-5-amino-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylic acid
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NENPYTRHICXVCS-YNEHKIRRSA-N
SMILES
CCC(CC)OC1C=C(CC(C1NC(=O)C)N)C(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2HU0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2hu0A1e2hu0B1e2hu0C1e2hu0D1e2hu0E1e2hu0F1e2hu0G1e2hu0H1
ECOD domains from experimental PDB structures interacting with ligand DB02600
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q6DPL2 | DB02600 | G39 | 2hu0 | e2hu0B1 | B:83-468 |
| Q6DPL2 | DB02600 | G39 | 2hu4 | e2hu4A1 | A:83-468 |
| Q6DPL2 | DB02600 | G39 | 2hu4 | e2hu4B1 | B:83-468 |
| Q6DPL2 | DB02600 | G39 | 2hu4 | e2hu4C1 | C:83-468 |
| Q6DPL2 | DB02600 | G39 | 2hu4 | e2hu4D1 | D:83-468 |
| Q6DPL2 | DB02600 | G39 | 2hu4 | e2hu4E1 | E:83-468 |
| Q6DPL2 | DB02600 | G39 | 2hu4 | e2hu4F1 | F:83-468 |
| Q6DPL2 | DB02600 | G39 | 2hu4 | e2hu4G1 | G:83-468 |
| Q6DPL2 | DB02600 | G39 | 2hu4 | e2hu4H1 | H:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl0 | e3cl0A1 | A:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl2 | e3cl2A1 | A:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl2 | e3cl2B1 | B:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl2 | e3cl2C1 | C:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl2 | e3cl2D1 | D:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl2 | e3cl2E1 | E:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl2 | e3cl2F1 | F:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl2 | e3cl2G1 | G:83-468 |
| Q6DPL2 | DB02600 | G39 | 3cl2 | e3cl2H1 | H:83-468 |