Attributes
UniProt ID
Protein Name
Kanamycin B dioxygenase
Ligand Name
(1R,2S,3S,4R,6S)-4,6-DIAMINO-3-[(3-AMINO-3-DEOXY-ALPHA-D-GLUCOPYRANOSYL)OXY]-2-HYDROXYCYCLOHEXYL 2,6-DIAMINO-2,6-DIDEOXY-ALPHA-D-GLUCOPYRANOSIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SKKLOUVUUNMCJE-FQSMHNGLSA-N
SMILES
C1C(C(C(C(C1N)OC2C(C(C(C(O2)CO)O)N)O)O)OC3C(C(C(C(O3)CN)O)O)N)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6S0W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6s0wA1e6s0wB1e6s0wC1e6s0wD1e6s0wE1e6s0wF1
ECOD domains from experimental PDB structures interacting with ligand DB13673
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q6L732 | DB13673 | 9CS | 6s0w | e6s0wA1 | A:3-277 |
| Q6L732 | DB13673 | 9CS | 6s0w | e6s0wB1 | B:2-283 |
| Q6L732 | DB13673 | 9CS | 6s0w | e6s0wC1 | C:1-277 |
| Q6L732 | DB13673 | 9CS | 6s0w | e6s0wD1 | D:-1-277 |
| Q6L732 | DB13673 | 9CS | 6s0w | e6s0wE1 | E:3-276 |
| Q6L732 | DB13673 | 9CS | 6s0w | e6s0wF1 | F:1-285 |
| Q6L732 | DB13673 | 9CS | 7cl3 | e7cl3A1 | A:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl3 | e7cl3B1 | B:24-282 |
| Q6L732 | DB13673 | 9CS | 7cl3 | e7cl3C1 | C:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl3 | e7cl3D1 | D:24-277 |
| Q6L732 | DB13673 | 9CS | 7cl3 | e7cl3E1 | E:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl3 | e7cl3F1 | F:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl5 | e7cl5A1 | A:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl5 | e7cl5B1 | B:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl5 | e7cl5C1 | C:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl5 | e7cl5D1 | D:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl5 | e7cl5E1 | E:24-284 |
| Q6L732 | DB13673 | 9CS | 7cl5 | e7cl5F1 | F:24-284 |