Attributes
UniProt ID
Protein Name
S-inosyl-L-homocysteine hydrolase
Ligand Name
INOSINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UGQMRVRMYYASKQ-KQYNXXCUSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)CO)O)O)N=CNC2=O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7R3A
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7r3aA1e7r3aA2e7r3aB1e7r3aB2e7r3aC1e7r3aC2e7r3aD1e7r3aD2e7r3aE1e7r3aE2e7r3aF1e7r3aF2e7r3aG1e7r3aG2e7r3aH1e7r3aH2
ECOD domains from experimental PDB structures interacting with ligand DB04335
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aA1 | A:196-360 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aA2 | A:22-198,A:361-432 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aB1 | B:196-360 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aB2 | B:22-198,B:361-432 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aC1 | C:22-198,C:361-432 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aC2 | C:196-360 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aD1 | D:22-198,D:361-432 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aD2 | D:196-360 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aE1 | E:196-360 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aE2 | E:22-198,E:361-432 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aF1 | F:22-198,F:361-432 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aF2 | F:196-360 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aG1 | G:22-198,G:361-432 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aG2 | G:196-360 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aH1 | H:22-198,H:361-432 |
| Q6LYR8 | DB04335 | NOS | 7r3a | e7r3aH2 | H:196-360 |