Attributes
UniProt ID
Protein Name
Endoplasmic reticulum aminopeptidase 2
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3SE6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3se6A1e3se6A2e3se6A3e3se6A4e3se6B1e3se6B2e3se6B3e3se6B4
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q6P179 | DB03814 | MES | 3se6 | e3se6A2 | A:638-961 |
| Q6P179 | DB03814 | MES | 3se6 | e3se6A4 | A:271-502,A:528-546 |
| Q6P179 | DB03814 | MES | 3se6 | e3se6B2 | B:268-502,B:532-535 |
| Q6P179 | DB03814 | MES | 3se6 | e3se6B3 | B:638-961 |
| Q6P179 | DB03814 | MES | 4e36 | e4e36A1 | A:638-961 |
| Q6P179 | DB03814 | MES | 4e36 | e4e36A3 | A:271-501,A:529-546 |
| Q6P179 | DB03814 | MES | 4e36 | e4e36B1 | B:268-502,B:532-535 |
| Q6P179 | DB03814 | MES | 4e36 | e4e36B3 | B:638-961 |
| Q6P179 | DB03814 | MES | 5ab0 | e5ab0A2 | A:271-546 |
| Q6P179 | DB03814 | MES | 6ea4 | e6ea4A2 | A:638-963 |
| Q6P179 | DB03814 | MES | 6ea4 | e6ea4A4 | A:271-501,A:530-546 |
| Q6P179 | DB03814 | MES | 6ea4 | e6ea4B2 | B:638-961 |
| Q6P179 | DB03814 | MES | 6ea4 | e6ea4B3 | B:271-501,B:534-546 |
| Q6P179 | DB03814 | MES | 7p7p | e7p7pA3 | A:271-546 |
| Q6P179 | DB03814 | MES | 7sh0 | e7sh0A1 | A:271-546 |
| Q6P179 | DB03814 | MES | 7sh0 | e7sh0A2 | A:54-270 |
| Q6P179 | DB03814 | MES | 7sh0 | e7sh0B1 | B:54-270 |