Attributes
UniProt ID
Protein Name
Pre-mRNA-processing-splicing factor 8
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5XJC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5xjcA1e5xjcA2e5xjcA3e5xjcA4e5xjcA5e5xjcA6e5xjcC1e5xjcC2e5xjcC3e5xjcC4e5xjcC5e5xjcD1e5xjcD10e5xjcD11e5xjcD12e5xjcD2e5xjcD3e5xjcD4e5xjcD5e5xjcD6e5xjcD7e5xjcD8e5xjcD9e5xjcE1e5xjcI1e5xjcJ1e5xjcN1e5xjcO1e5xjcO2e5xjcO3e5xjcQ1e5xjcQ2e5xjcQ3e5xjcQ4e5xjcQ5e5xjcS1e5xjcT1e5xjcV1e5xjcV2e5xjcW1e5xjcZ1e5xjcZ2e5xjca1e5xjcb1e5xjcc1e5xjcd1e5xjce1e5xjcf1e5xjcg1e5xjch1e5xjci1e5xjcj1e5xjck1e5xjcl1e5xjcm1e5xjcn1e5xjco1e5xjcp1e5xjcu1e5xjcu2e5xjcv1e5xjcw1
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q6P2Q9 | DB04137 | GTP | 5xjc | e5xjcA2 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 5yzg | e5yzgA6 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 5z56 | e5z56A3 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 5z57 | e5z57A1 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 5z58 | e5z58A5 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 6ah0 | e6ah0A2 | A:56-810 |
| Q6P2Q9 | DB04137 | GTP | 6ahd | e6ahdA3 | A:56-810 |
| Q6P2Q9 | DB04137 | GTP | 6ff4 | e6ff4A1 | A:26-810 |
| Q6P2Q9 | DB04137 | GTP | 6ff7 | e6ff7A4 | A:26-810 |
| Q6P2Q9 | DB04137 | GTP | 6icz | e6iczA1 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 6id0 | e6id0A3 | A:25-811 |
| Q6P2Q9 | DB04137 | GTP | 6id1 | e6id1A1 | A:25-811 |
| Q6P2Q9 | DB04137 | GTP | 6qdv | e6qdvA5 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 6qw6 | e6qw65A1 | 5A:25-658,5A:679-810 |
| Q6P2Q9 | DB04137 | GTP | 6qx9 | e6qx95A5 | 5A:25-658,5A:679-810 |
| Q6P2Q9 | DB04137 | GTP | 6zym | e6zymA1 | A:26-811 |
| Q6P2Q9 | DB04137 | GTP | 7abf | e7abfA1 | A:63-811 |
| Q6P2Q9 | DB04137 | GTP | 7abg | e7abgA5 | A:63-810 |
| Q6P2Q9 | DB04137 | GTP | 7abi | e7abiA2 | A:63-810 |
| Q6P2Q9 | DB04137 | GTP | 7dvq | e7dvqA5 | A:27-810 |
| Q6P2Q9 | DB04137 | GTP | 7qtt | e7qtta4 | a:53-811 |
| Q6P2Q9 | DB04137 | GTP | 7w59 | e7w59A1 | A:25-811 |
| Q6P2Q9 | DB04137 | GTP | 7w5a | e7w5aA3 | A:25-811 |
| Q6P2Q9 | DB04137 | GTP | 7w5b | e7w5bA4 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 8c6j | e8c6jA3 | A:25-810 |
| Q6P2Q9 | DB04137 | GTP | 8ch6 | e8ch6a1 | a:53-810 |