Attributes
UniProt ID
Protein Name
Actin, cytoplasmic 1
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5AFU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5afu31e5afu41e5afuA1e5afuA2e5afuB1e5afuB2e5afuC1e5afuC2e5afuD1e5afuD2e5afuE1e5afuE2e5afuF1e5afuF2e5afuG1e5afuG2e5afuH1e5afuH2e5afuI1e5afuI2e5afuJ1e5afuJ2e5afuK1e5afuK2e5afuK3e5afuL1e5afuL2e5afuL3e5afuU1e5afuV1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q6QAQ1 | DB00171 | ATP | 5afu | e5afuH1 | H:147-375 |
| Q6QAQ1 | DB00171 | ATP | 5afu | e5afuH2 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6f1t | e6f1tH1 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6f1t | e6f1tH2 | H:147-375 |
| Q6QAQ1 | DB00171 | ATP | 6f38 | e6f38H1 | H:147-375 |
| Q6QAQ1 | DB00171 | ATP | 6f38 | e6f38H2 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6f3a | e6f3aH1 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6f3a | e6f3aH2 | H:147-375 |
| Q6QAQ1 | DB00171 | ATP | 6znl | e6znlH1 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6znl | e6znlH2 | H:147-375 |
| Q6QAQ1 | DB00171 | ATP | 6znm | e6znmH1 | H:147-375 |
| Q6QAQ1 | DB00171 | ATP | 6znm | e6znmH2 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6znn | e6znnH1 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6znn | e6znnH2 | H:147-375 |
| Q6QAQ1 | DB00171 | ATP | 6zno | e6znoH1 | H:147-375 |
| Q6QAQ1 | DB00171 | ATP | 6zno | e6znoH2 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6zo4 | e6zo4H1 | H:6-146 |
| Q6QAQ1 | DB00171 | ATP | 6zo4 | e6zo4H2 | H:147-375 |