Attributes
UniProt ID
Protein Name
Outer membrane protein Omp38
Ligand Name
2,6-DIAMINOPIMELIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
GMKMEZVLHJARHF-SYDPRGILSA-N
SMILES
C(CC(C(=O)O)N)CC(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3TD4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3td4A1e3td4B1e3td4C1e3td4D1e3td4E1e3td4F1e3td4G1e3td4H1
ECOD domains from experimental PDB structures interacting with ligand DB03590
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q6RYW5 | DB03590 | API | 3td4 | e3td4A1 | A:218-339 |
| Q6RYW5 | DB03590 | API | 3td4 | e3td4B1 | B:217-339 |
| Q6RYW5 | DB03590 | API | 3td4 | e3td4C1 | C:219-339 |
| Q6RYW5 | DB03590 | API | 3td4 | e3td4D1 | D:219-339 |
| Q6RYW5 | DB03590 | API | 3td4 | e3td4E1 | E:220-339 |
| Q6RYW5 | DB03590 | API | 3td4 | e3td4F1 | F:218-339 |
| Q6RYW5 | DB03590 | API | 3td4 | e3td4G1 | G:218-339 |
| Q6RYW5 | DB03590 | API | 3td4 | e3td4H1 | H:219-339 |
| Q6RYW5 | DB03590 | API | 4g88 | e4g88A1 | A:218-339 |
| Q6RYW5 | DB03590 | API | 4g88 | e4g88B1 | B:218-339 |
| Q6RYW5 | DB03590 | API | 4g88 | e4g88C1 | C:220-339 |
| Q6RYW5 | DB03590 | API | 4g88 | e4g88D1 | D:217-339 |
| Q6RYW5 | DB03590 | API | 4g88 | e4g88E1 | E:220-339 |
| Q6RYW5 | DB03590 | API | 4g88 | e4g88F1 | F:218-339 |
| Q6RYW5 | DB03590 | API | 4g88 | e4g88G1 | G:217-339 |
| Q6RYW5 | DB03590 | API | 4g88 | e4g88H1 | H:219-339 |