Attributes
UniProt ID
Protein Name
Cytochrome c nitrite reductase subunit NrfA
Ligand Name
HEME C
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES
CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2J7A
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2j7aA1e2j7aB1e2j7aC1e2j7aD1e2j7aE1e2j7aF1e2j7aG1e2j7aH1e2j7aI1e2j7aJ1e2j7aK1e2j7aL1e2j7aM1e2j7aN1e2j7aO1e2j7aP1e2j7aQ1e2j7aR1
ECOD domains from experimental PDB structures interacting with ligand DB03317
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aA1 | A:26-520 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aB1 | B:25-522 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aD1 | D:26-519 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aE1 | E:26-519 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aG1 | G:26-519 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aH1 | H:26-522 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aJ1 | J:26-519 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aK1 | K:25-520 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aM1 | M:26-519 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aN1 | N:25-522 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aP1 | P:26-519 |
| Q72EF3 | DB03317 | HEC | 2j7a | e2j7aQ1 | Q:26-520 |
| Q72EF3 | DB03317 | HEC | 2vr0 | e2vr0A1 | A:26-520 |
| Q72EF3 | DB03317 | HEC | 2vr0 | e2vr0B1 | B:25-522 |
| Q72EF3 | DB03317 | HEC | 2vr0 | e2vr0D1 | D:26-519 |
| Q72EF3 | DB03317 | HEC | 2vr0 | e2vr0E1 | E:25-519 |