Attributes
UniProt ID
Protein Name
2-aminoadipate transaminase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2EGY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2egyA2e2egyA3e2egyB2e2egyB3e2egyC2e2egyC3e2egyD2e2egyD3
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q72LL6 | DB00114 | PLP | 2egy | e2egyA2 | A:5-285 |
| Q72LL6 | DB00114 | PLP | 2egy | e2egyA3 | A:286-396 |
| Q72LL6 | DB00114 | PLP | 2egy | e2egyB2 | B:2-285 |
| Q72LL6 | DB00114 | PLP | 2egy | e2egyB3 | B:286-395 |
| Q72LL6 | DB00114 | PLP | 2egy | e2egyC2 | C:2-285 |
| Q72LL6 | DB00114 | PLP | 2egy | e2egyC3 | C:286-397 |
| Q72LL6 | DB00114 | PLP | 2egy | e2egyD2 | D:5-285 |
| Q72LL6 | DB00114 | PLP | 2egy | e2egyD3 | D:286-395 |
| Q72LL6 | DB00114 | PLP | 2z1y | e2z1yA2 | A:4-285 |
| Q72LL6 | DB00114 | PLP | 2z1y | e2z1yA3 | A:286-397 |
| Q72LL6 | DB00114 | PLP | 2z1y | e2z1yB2 | B:4-285 |
| Q72LL6 | DB00114 | PLP | 2z1y | e2z1yB3 | B:286-397 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7A2 | A:5-285 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7A3 | A:286-395 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7B2 | B:5-285 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7B3 | B:286-395 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7C2 | C:5-285 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7C3 | C:286-395 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7D2 | D:5-285 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7D3 | D:286-395 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7E2 | E:5-285 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7E3 | E:286-395 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7F2 | F:5-285 |
| Q72LL6 | DB00114 | PLP | 2zp7 | e2zp7F3 | F:286-395 |