Attributes
UniProt ID
Protein Name
Glyceraldehyde-3-phosphate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8OHA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8ohaA1e8ohaA2e8ohaB1e8ohaB2e8ohaC1e8ohaC2e8ohaD1e8ohaD2e8ohaE1e8ohaE2e8ohaF1e8ohaF2e8ohaG1e8ohaG2e8ohaH1e8ohaH2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaA1 | A:151-314 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaA2 | A:1-150,A:315-334 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaB1 | B:-1-150,B:315-334 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaB2 | B:151-314 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaC1 | C:1-150,C:315-334 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaC2 | C:151-314 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaD1 | D:151-314 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaD2 | D:1-150,D:315-333 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaE1 | E:1-150,E:315-334 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaE2 | E:151-314 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaF1 | F:151-314 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaF2 | F:0-150,F:315-334 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaG1 | G:1-150,G:315-334 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaG2 | G:151-314 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaH1 | H:0-150,H:315-333 |
| Q72QM3 | DB14128 | NAD | 8oha | e8ohaH2 | H:151-314 |