Attributes
UniProt ID
Protein Name
Inosine-5'-monophosphate dehydrogenase
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4Z87
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4z87A1e4z87A2e4z87B1e4z87B2e4z87C1e4z87C2e4z87D1e4z87D2
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q756Z6 | DB04315 | GDP | 4z87 | e4z87A1 | A:1-117,A:244-522 |
| Q756Z6 | DB04315 | GDP | 4z87 | e4z87A2 | A:118-243 |
| Q756Z6 | DB04315 | GDP | 4z87 | e4z87B1 | B:2-118,B:235-424,B:446-522 |
| Q756Z6 | DB04315 | GDP | 4z87 | e4z87B2 | B:119-234 |
| Q756Z6 | DB04315 | GDP | 4z87 | e4z87C1 | C:119-234 |
| Q756Z6 | DB04315 | GDP | 4z87 | e4z87C2 | C:2-118,C:235-424,C:444-521 |
| Q756Z6 | DB04315 | GDP | 4z87 | e4z87D1 | D:119-234 |
| Q756Z6 | DB04315 | GDP | 4z87 | e4z87D2 | D:2-118,D:235-419,D:447-517 |
| Q756Z6 | DB04315 | GDP | 5tc3 | e5tc3A1 | A:2-118,A:235-422,A:447-522 |
| Q756Z6 | DB04315 | GDP | 5tc3 | e5tc3A2 | A:119-234 |
| Q756Z6 | DB04315 | GDP | 5tc3 | e5tc3B1 | B:119-234 |
| Q756Z6 | DB04315 | GDP | 5tc3 | e5tc3B2 | B:2-118,B:235-423,B:447-522 |
| Q756Z6 | DB04315 | GDP | 6rpu | e6rpuA1 | A:3-118,A:235-401,A:456-502 |
| Q756Z6 | DB04315 | GDP | 6rpu | e6rpuA2 | A:119-234 |