Attributes
UniProt ID
Protein Name
deleted
Ligand Name
ACETOACETYL-COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OJFDKHTZOUZBOS-CITAKDKDSA-N
SMILES
CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1XPK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1xpkA1e1xpkA2e1xpkB1e1xpkB2e1xpkC1e1xpkC2e1xpkD1e1xpkD2
ECOD domains from experimental PDB structures interacting with ligand DB03059
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q79ZY6 | DB03059 | CAA | 1xpk | e1xpkA1 | A:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpk | e1xpkA2 | A:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpk | e1xpkB1 | B:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpk | e1xpkB2 | B:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpk | e1xpkD1 | D:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpk | e1xpkD2 | D:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpl | e1xplA1 | A:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpl | e1xplA2 | A:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpl | e1xplB1 | B:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpl | e1xplB2 | B:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpl | e1xplC1 | C:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpl | e1xplC2 | C:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpl | e1xplD1 | D:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpl | e1xplD2 | D:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpm | e1xpmA1 | A:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpm | e1xpmA2 | A:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpm | e1xpmB1 | B:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpm | e1xpmB2 | B:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpm | e1xpmC1 | C:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpm | e1xpmC2 | C:168-388 |
| Q79ZY6 | DB03059 | CAA | 1xpm | e1xpmD1 | D:2-167 |
| Q79ZY6 | DB03059 | CAA | 1xpm | e1xpmD2 | D:168-388 |