Attributes
UniProt ID
Protein Name
Sodium-dependent dopamine transporter
Ligand Name
CHOLESTEROL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HVYWMOMLDIMFJA-DPAQBDIFSA-N
SMILES
CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4XNU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4xnuA1e4xnuH1e4xnuH2e4xnuL1e4xnuL2
ECOD domains from experimental PDB structures interacting with ligand DB04540
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q7K4Y6 | DB04540 | CLR | 4xnu | e4xnuA1 | A:25-599 |
| Q7K4Y6 | DB04540 | CLR | 4xp4 | e4xp4A1 | A:25-599 |
| Q7K4Y6 | DB04540 | CLR | 4xpa | e4xpaA1 | A:25-599 |
| Q7K4Y6 | DB04540 | CLR | 4xpb | e4xpbA1 | A:25-599 |
| Q7K4Y6 | DB04540 | CLR | 4xpf | e4xpfA1 | A:20-594 |
| Q7K4Y6 | DB04540 | CLR | 4xpg | e4xpgA1 | A:25-600 |
| Q7K4Y6 | DB04540 | CLR | 4xpt | e4xptA1 | A:25-599 |
| Q7K4Y6 | DB04540 | CLR | 6m0f | e6m0fA1 | A:25-599 |
| Q7K4Y6 | DB04540 | CLR | 6m0z | e6m0zA1 | A:25-601 |
| Q7K4Y6 | DB04540 | CLR | 6m2r | e6m2rA1 | A:25-601 |
| Q7K4Y6 | DB04540 | CLR | 6m38 | e6m38A1 | A:25-599 |
| Q7K4Y6 | DB04540 | CLR | 6m3z | e6m3zA1 | A:25-601 |
| Q7K4Y6 | DB04540 | CLR | 6m47 | e6m47A1 | A:25-599 |
| Q7K4Y6 | DB04540 | CLR | 7wgd | e7wgdA1 | A:25-601 |
| Q7K4Y6 | DB04540 | CLR | 7wgt | e7wgtA1 | A:25-601 |
| Q7K4Y6 | DB04540 | CLR | 7wlw | e7wlwA1 | A:25-601 |