Attributes
UniProt ID
Protein Name
Ras-related GTP-binding protein A
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6S6A
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6s6aA1e6s6aA2e6s6aB1e6s6aB2e6s6aC1e6s6aC2e6s6aD1e6s6aD2
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q7L523 | DB04137 | GTP | 6s6a | e6s6aA1 | A:4-181 |
| Q7L523 | DB04137 | GTP | 6s6a | e6s6aB2 | B:5-181 |
| Q7L523 | DB04137 | GTP | 6s6d | e6s6dA2 | A:4-181 |
| Q7L523 | DB04137 | GTP | 6s6d | e6s6dB2 | B:4-181 |
| Q7L523 | DB04137 | GTP | 6sb0 | e6sb0C1 | C:4-181 |
| Q7L523 | DB04137 | GTP | 6sb0 | e6sb0I1 | I:4-181 |
| Q7L523 | DB04137 | GTP | 6sb2 | e6sb2C2 | C:4-181 |
| Q7L523 | DB04137 | GTP | 6sb2 | e6sb2I1 | I:4-181 |
| Q7L523 | DB04137 | GTP | 6u62 | e6u62B1 | B:5-181 |
| Q7L523 | DB04137 | GTP | 7ux2 | e7ux2B2 | B:5-181 |
| Q7L523 | DB04137 | GTP | 7ux2 | e7ux2I2 | I:5-181 |
| Q7L523 | DB04137 | GTP | 7uxc | e7uxcD1 | D:5-181 |
| Q7L523 | DB04137 | GTP | 7uxc | e7uxcK1 | K:5-181 |
| Q7L523 | DB04137 | GTP | 7uxh | e7uxhF2 | F:5-181 |
| Q7L523 | DB04137 | GTP | 7uxh | e7uxhM2 | M:5-181 |
| Q7L523 | DB04137 | GTP | 7uxh | e7uxhV1 | V:5-181 |
| Q7L523 | DB04137 | GTP | 7uxh | e7uxhc2 | c:5-181 |