Attributes
UniProt ID
Protein Name
1-aminocyclopropane-1-carboxylate deaminase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1F2D
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1f2dA1e1f2dA2e1f2dB1e1f2dB2e1f2dC1e1f2dC2e1f2dD1e1f2dD2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q7M523 | DB00114 | PLP | 1f2d | e1f2dA1 | A:1-172 |
| Q7M523 | DB00114 | PLP | 1f2d | e1f2dA2 | A:173-341 |
| Q7M523 | DB00114 | PLP | 1f2d | e1f2dB1 | B:1-172 |
| Q7M523 | DB00114 | PLP | 1f2d | e1f2dB2 | B:173-341 |
| Q7M523 | DB00114 | PLP | 1f2d | e1f2dC1 | C:173-341 |
| Q7M523 | DB00114 | PLP | 1f2d | e1f2dC2 | C:1-172 |
| Q7M523 | DB00114 | PLP | 1f2d | e1f2dD1 | D:1-172 |
| Q7M523 | DB00114 | PLP | 1f2d | e1f2dD2 | D:173-341 |
| Q7M523 | DB00114 | PLP | 1j0c | e1j0cA1 | A:1-172 |
| Q7M523 | DB00114 | PLP | 1j0c | e1j0cA2 | A:173-341 |
| Q7M523 | DB00114 | PLP | 1j0c | e1j0cB1 | B:1-172 |
| Q7M523 | DB00114 | PLP | 1j0c | e1j0cB2 | B:173-341 |
| Q7M523 | DB00114 | PLP | 1j0c | e1j0cC1 | C:1-172 |
| Q7M523 | DB00114 | PLP | 1j0c | e1j0cC2 | C:173-341 |
| Q7M523 | DB00114 | PLP | 1j0c | e1j0cD1 | D:173-341 |
| Q7M523 | DB00114 | PLP | 1j0c | e1j0cD2 | D:1-172 |