Attributes
UniProt ID
Protein Name
n/a
Ligand Name
COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGJOEKWQDUBAIZ-IBOSZNHHSA-N
SMILES
CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3ICR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3icrA10e3icrA11e3icrA12e3icrA9e3icrB10e3icrB11e3icrB12e3icrB9
ECOD domains from experimental PDB structures interacting with ligand DB01992
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q81UT5 | DB01992 | COA | 3icr | e3icrA10 | A:126-324 |
| Q81UT5 | DB01992 | COA | 3icr | e3icrA11 | A:449-554 |
| Q81UT5 | DB01992 | COA | 3icr | e3icrA12 | A:0-125 |
| Q81UT5 | DB01992 | COA | 3icr | e3icrA9 | A:325-448 |
| Q81UT5 | DB01992 | COA | 3icr | e3icrB10 | B:128-324 |
| Q81UT5 | DB01992 | COA | 3icr | e3icrB11 | B:449-554 |
| Q81UT5 | DB01992 | COA | 3icr | e3icrB12 | B:1-127 |
| Q81UT5 | DB01992 | COA | 3icr | e3icrB9 | B:325-448 |
| Q81UT5 | DB01992 | COA | 3ics | e3icsA10 | A:127-324 |
| Q81UT5 | DB01992 | COA | 3ics | e3icsA11 | A:449-554 |
| Q81UT5 | DB01992 | COA | 3ics | e3icsA12 | A:0-126 |
| Q81UT5 | DB01992 | COA | 3ics | e3icsA9 | A:325-448 |
| Q81UT5 | DB01992 | COA | 3ics | e3icsB10 | B:128-324 |
| Q81UT5 | DB01992 | COA | 3ics | e3icsB11 | B:449-554 |
| Q81UT5 | DB01992 | COA | 3ics | e3icsB12 | B:1-127 |
| Q81UT5 | DB01992 | COA | 3ics | e3icsB9 | B:325-448 |
| Q81UT5 | DB01992 | COA | 3ict | e3ictA1 | A:127-324 |
| Q81UT5 | DB01992 | COA | 3ict | e3ictA2 | A:449-554 |
| Q81UT5 | DB01992 | COA | 3ict | e3ictA3 | A:325-448 |
| Q81UT5 | DB01992 | COA | 3ict | e3ictA4 | A:-2-126 |
| Q81UT5 | DB01992 | COA | 3ict | e3ictB10 | B:127-324 |
| Q81UT5 | DB01992 | COA | 3ict | e3ictB11 | B:449-554 |
| Q81UT5 | DB01992 | COA | 3ict | e3ictB12 | B:2-126 |
| Q81UT5 | DB01992 | COA | 3ict | e3ictB9 | B:325-448 |