Attributes
UniProt ID
Protein Name
n/a
Ligand Name
(2R,3Z,5R)-3-(2-HYDROXYETHYLIDENE)-7-OXO-4-OXA-1-AZABICYCLO[3.2.0]HEPTANE-2-CARBOXYLIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HZZVJAQRINQKSD-PBFISZAISA-N
SMILES
C1C2N(C1=O)C(C(=CCO)O2)C(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2XF3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2xf3A1e2xf3A2e2xf3A3e2xf3B1e2xf3B2e2xf3B3
ECOD domains from experimental PDB structures interacting with ligand DB00766
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q83Z62 | DB00766 | J01 | 2xf3 | e2xf3A1 | A:8-121 |
| Q83Z62 | DB00766 | J01 | 2xf3 | e2xf3A2 | A:170-327 |
| Q83Z62 | DB00766 | J01 | 2xf3 | e2xf3A3 | A:122-169,A:328-434 |
| Q83Z62 | DB00766 | J01 | 2xf3 | e2xf3B1 | B:8-121 |
| Q83Z62 | DB00766 | J01 | 2xf3 | e2xf3B2 | B:122-169,B:328-435 |
| Q83Z62 | DB00766 | J01 | 2xf3 | e2xf3B3 | B:170-327 |
| Q83Z62 | DB00766 | J01 | 2xfs | e2xfsA1 | A:170-327 |
| Q83Z62 | DB00766 | J01 | 2xfs | e2xfsA2 | A:8-121 |
| Q83Z62 | DB00766 | J01 | 2xfs | e2xfsA3 | A:122-169,A:328-434 |
| Q83Z62 | DB00766 | J01 | 2xfs | e2xfsB1 | B:170-327 |
| Q83Z62 | DB00766 | J01 | 2xfs | e2xfsB2 | B:8-121 |
| Q83Z62 | DB00766 | J01 | 2xfs | e2xfsB3 | B:122-169,B:328-435 |
| Q83Z62 | DB00766 | J01 | 2xh9 | e2xh9A1 | A:122-169,A:328-434 |
| Q83Z62 | DB00766 | J01 | 2xh9 | e2xh9A2 | A:170-327 |
| Q83Z62 | DB00766 | J01 | 2xh9 | e2xh9A3 | A:8-121 |
| Q83Z62 | DB00766 | J01 | 2xh9 | e2xh9B1 | B:170-327 |
| Q83Z62 | DB00766 | J01 | 2xh9 | e2xh9B2 | B:8-121 |
| Q83Z62 | DB00766 | J01 | 2xh9 | e2xh9B3 | B:122-169,B:328-435 |