Attributes
UniProt ID
Protein Name
Arginine/Ornithine decarboxylase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2NV9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2nv9A1e2nv9A2e2nv9B1e2nv9B2e2nv9C1e2nv9C2e2nv9D1e2nv9D2e2nv9E1e2nv9E2e2nv9F1e2nv9F2e2nv9G1e2nv9G2e2nv9H1e2nv9H2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9A1 | A:33-258 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9A2 | A:1-32,A:259-372 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9B1 | B:1-32,B:258-372 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9B2 | B:33-257 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9C1 | C:1-32,C:258-372 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9C2 | C:33-257 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9D1 | D:1-32,D:258-372 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9D2 | D:33-257 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9E1 | E:1-32,E:258-372 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9E2 | E:33-257 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9F1 | F:1-32,F:258-372 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9F2 | F:33-257 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9G1 | G:33-258 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9G2 | G:1-33,G:259-372 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9H1 | H:1-32,H:258-372 |
| Q84527 | DB00114 | PLP | 2nv9 | e2nv9H2 | H:33-257 |