Attributes
UniProt ID
Protein Name
Sensory box protein
Ligand Name
FLAVIN MONONUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FVTCRASFADXXNN-SCRDCRAPSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3SW1
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3sw1A1e3sw1B2
ECOD domains from experimental PDB structures interacting with ligand DB03247
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q88E39 | DB03247 | FMN | 3sw1 | e3sw1A1 | A:1-134 |
| Q88E39 | DB03247 | FMN | 3sw1 | e3sw1B2 | B:1-134 |
| Q88E39 | DB03247 | FMN | 5j3w | e5j3wA1 | A:1-133 |
| Q88E39 | DB03247 | FMN | 5j3w | e5j3wB1 | B:1-134 |
| Q88E39 | DB03247 | FMN | 5j3w | e5j3wC1 | C:1-134 |
| Q88E39 | DB03247 | FMN | 5j3w | e5j3wD1 | D:1-134 |
| Q88E39 | DB03247 | FMN | 5j4e | e5j4eA1 | A:1-133 |
| Q88E39 | DB03247 | FMN | 5j4e | e5j4eB1 | B:1-134 |
| Q88E39 | DB03247 | FMN | 5j4e | e5j4eC1 | C:1-134 |
| Q88E39 | DB03247 | FMN | 5j4e | e5j4eD1 | D:1-134 |
| Q88E39 | DB03247 | FMN | 6gg9 | e6gg9A1 | A:-1-132 |
| Q88E39 | DB03247 | FMN | 6gg9 | e6gg9B1 | B:1-135 |
| Q88E39 | DB03247 | FMN | 6gg9 | e6gg9C1 | C:1-134 |
| Q88E39 | DB03247 | FMN | 6gg9 | e6gg9D1 | D:1-135 |
| Q88E39 | DB03247 | FMN | 7r4s | e7r4sA1 | A:2-132 |
| Q88E39 | DB03247 | FMN | 7r4s | e7r4sB1 | B:2-133 |
| Q88E39 | DB03247 | FMN | 7r4s | e7r4sC1 | C:1-133 |
| Q88E39 | DB03247 | FMN | 7r4s | e7r4sD1 | D:0-132 |
| Q88E39 | DB03247 | FMN | 7r56 | e7r56A1 | A:-2-134 |
| Q88E39 | DB03247 | FMN | 8a36 | e8a36A1 | A:2-134 |
| Q88E39 | DB03247 | FMN | 8a36 | e8a36B1 | B:2-134 |
| Q88E39 | DB03247 | FMN | 8a36 | e8a36C1 | C:2-133 |
| Q88E39 | DB03247 | FMN | 8a36 | e8a36D1 | D:2-134 |
| Q88E39 | DB03247 | FMN | 8a37 | e8a37A1 | A:1-133 |