Attributes
UniProt ID
Protein Name
Sulfhydryl oxidase 1
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3T58
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3t58A1e3t58A3e3t58A5e3t58A6e3t58B1e3t58B3e3t58B5e3t58B6e3t58C1e3t58C3e3t58C5e3t58C6e3t58D1e3t58D2e3t58D3
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58A1 | A:289-394 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58A3 | A:395-547 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58A5 | A:36-162 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58B1 | B:287-394 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58B3 | B:395-548 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58B5 | B:36-162 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58C1 | C:36-162 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58C3 | C:290-394 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58C5 | C:395-548 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58D1 | D:37-167 |
| Q8BND5 | DB03147 | FAD | 3t58 | e3t58D2 | D:273-547 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59A4 | A:289-394 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59A5 | A:395-548 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59A6 | A:36-162 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59B1 | B:395-549 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59B3 | B:287-394 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59B6 | B:38-162 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59C3 | C:395-548 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59C5 | C:37-162 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59C6 | C:290-394 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59D1 | D:38-162 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59D5 | D:395-547 |
| Q8BND5 | DB03147 | FAD | 3t59 | e3t59D6 | D:290-394 |