Attributes
UniProt ID
Protein Name
Cyclic GMP-AMP synthase
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4K98
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4k98A1e4k98A2
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8C6L5 | DB04137 | GTP | 4k98 | e4k98A1 | A:372-499 |
| Q8C6L5 | DB04137 | GTP | 4k98 | e4k98A2 | A:146-371 |
| Q8C6L5 | DB04137 | GTP | 7buj | e7bujA1 | A:147-378 |
| Q8C6L5 | DB04137 | GTP | 7buj | e7bujA2 | A:379-507 |
| Q8C6L5 | DB04137 | GTP | 7buj | e7bujB1 | B:379-507 |
| Q8C6L5 | DB04137 | GTP | 7buj | e7bujB2 | B:146-378 |
| Q8C6L5 | DB04137 | GTP | 7uxw | e7uxwA1 | A:148-378 |
| Q8C6L5 | DB04137 | GTP | 7uxw | e7uxwA2 | A:379-507 |
| Q8C6L5 | DB04137 | GTP | 7uxw | e7uxwC2 | C:149-378 |
| Q8C6L5 | DB04137 | GTP | 7uyq | e7uyqA1 | A:147-378 |
| Q8C6L5 | DB04137 | GTP | 7uyq | e7uyqA2 | A:379-507 |
| Q8C6L5 | DB04137 | GTP | 7uyq | e7uyqC1 | C:379-507 |
| Q8C6L5 | DB04137 | GTP | 7uyq | e7uyqC2 | C:149-378 |
| Q8C6L5 | DB04137 | GTP | 7uyz | e7uyzA1 | A:384-506 |
| Q8C6L5 | DB04137 | GTP | 7uyz | e7uyzA2 | A:149-383 |
| Q8C6L5 | DB04137 | GTP | 7uyz | e7uyzC1 | C:149-383 |
| Q8C6L5 | DB04137 | GTP | 7uyz | e7uyzC2 | C:384-506 |
| Q8C6L5 | DB04137 | GTP | 7v0w | e7v0wA1 | A:149-383 |
| Q8C6L5 | DB04137 | GTP | 7v0w | e7v0wA2 | A:384-506 |
| Q8C6L5 | DB04137 | GTP | 7v0w | e7v0wC1 | C:149-383 |
| Q8C6L5 | DB04137 | GTP | 7v0w | e7v0wC2 | C:384-506 |