Attributes
UniProt ID
Protein Name
Cytochrome b559 subunit beta
Ligand Name
HEME C
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES
CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1S5L
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1s5lA1e1s5lB1e1s5lB2e1s5lC1e1s5lD1e1s5lE1e1s5lF1e1s5lH1e1s5lI1e1s5lJ1e1s5lK1e1s5lL1e1s5lM1e1s5lO1e1s5lT1e1s5lU1e1s5lV1e1s5lX1e1s5lZ1e1s5la1e1s5lb1e1s5lb2e1s5lc1e1s5ld1e1s5le1e1s5lf1e1s5lh1e1s5li1e1s5lj1e1s5lk1e1s5ll1e1s5lm1e1s5lo1e1s5lt1e1s5lu1e1s5lv1e1s5lx1e1s5lz1
ECOD domains from experimental PDB structures interacting with ligand DB03317
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8DIN9 | DB03317 | HEC | 1s5l | e1s5lF1 | F:12-44 |
| Q8DIN9 | DB03317 | HEC | 1s5l | e1s5lf1 | f:2012-2044 |
| Q8DIN9 | DB03317 | HEC | 6w1o | e6w1oF1 | F:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1o | e6w1of1 | f:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1p | e6w1pF1 | F:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1p | e6w1pf1 | f:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1q | e6w1qF1 | F:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1q | e6w1qf1 | f:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1r | e6w1rF1 | F:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1r | e6w1rf1 | f:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1t | e6w1tF1 | F:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1t | e6w1tf1 | f:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1u | e6w1uF1 | F:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1u | e6w1uf1 | f:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1v | e6w1vF1 | F:12-45 |
| Q8DIN9 | DB03317 | HEC | 6w1v | e6w1vf1 | f:12-45 |