Attributes
UniProt ID
Protein Name
Cytochrome b559 subunit alpha
Ligand Name
2,3-DIMETHYL-5-(3,7,11,15,19,23,27,31,35-NONAMETHYL-2,6,10,14,18,22,26,30,34-HEXATRIACONTANONAENYL-2,5-CYCLOHEXADIENE-1,4-DIONE-2,3-DIMETHYL-5-SOLANESYL-1,4-BENZOQUINONE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FKUYMLZIRPABFK-UHFFFAOYSA-N
SMILES
CC1=C(C(=O)C(=CC1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1S5L
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1s5lA1e1s5lB1e1s5lB2e1s5lC1e1s5lD1e1s5lE1e1s5lF1e1s5lH1e1s5lI1e1s5lJ1e1s5lK1e1s5lL1e1s5lM1e1s5lO1e1s5lT1e1s5lU1e1s5lV1e1s5lX1e1s5lZ1e1s5la1e1s5lb1e1s5lb2e1s5lc1e1s5ld1e1s5le1e1s5lf1e1s5lh1e1s5li1e1s5lj1e1s5lk1e1s5ll1e1s5lm1e1s5lo1e1s5lt1e1s5lu1e1s5lv1e1s5lx1e1s5lz1
ECOD domains from experimental PDB structures interacting with ligand PL9
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8DIP0 | n/a | PL9 | 1s5l | e1s5lE1 | E:8-83 |
| Q8DIP0 | n/a | PL9 | 1s5l | e1s5le1 | e:2008-2083 |
| Q8DIP0 | n/a | PL9 | 4fby | e4fbyE1 | E:2-84 |
| Q8DIP0 | n/a | PL9 | 4fby | e4fbyR1 | R:2-83 |
| Q8DIP0 | n/a | PL9 | 4ixq | e4ixqE1 | E:3-84 |
| Q8DIP0 | n/a | PL9 | 4ixq | e4ixqe1 | e:1-81 |
| Q8DIP0 | n/a | PL9 | 4ixr | e4ixrE1 | E:1-81 |
| Q8DIP0 | n/a | PL9 | 4ixr | e4ixre1 | e:1-81 |
| Q8DIP0 | n/a | PL9 | 4tnh | e4tnhE1 | E:3-84 |
| Q8DIP0 | n/a | PL9 | 4tnh | e4tnhe1 | e:3-84 |
| Q8DIP0 | n/a | PL9 | 4tni | e4tniE1 | E:3-84 |
| Q8DIP0 | n/a | PL9 | 4tni | e4tnie1 | e:3-84 |
| Q8DIP0 | n/a | PL9 | 4tnj | e4tnjE1 | E:3-84 |
| Q8DIP0 | n/a | PL9 | 4tnj | e4tnje1 | e:3-84 |
| Q8DIP0 | n/a | PL9 | 4tnk | e4tnkE1 | E:3-84 |
| Q8DIP0 | n/a | PL9 | 4tnk | e4tnke1 | e:3-84 |
| Q8DIP0 | n/a | PL9 | 4v62 | e4v62AE1 | AE:3-84 |
| Q8DIP0 | n/a | PL9 | 4v62 | e4v62BE1 | BE:3-84 |