Attributes
UniProt ID
Protein Name
Glyceraldehyde-3-phosphate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4QX6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4qx6A1e4qx6A2e4qx6B1e4qx6B2e4qx6C1e4qx6C2e4qx6D1e4qx6D2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8E3E8 | DB14128 | NAD | 4qx6 | e4qx6A1 | A:152-315 |
| Q8E3E8 | DB14128 | NAD | 4qx6 | e4qx6A2 | A:3-151,A:316-335 |
| Q8E3E8 | DB14128 | NAD | 4qx6 | e4qx6B1 | B:152-315 |
| Q8E3E8 | DB14128 | NAD | 4qx6 | e4qx6B2 | B:2-151,B:316-336 |
| Q8E3E8 | DB14128 | NAD | 4qx6 | e4qx6C1 | C:152-315 |
| Q8E3E8 | DB14128 | NAD | 4qx6 | e4qx6C2 | C:2-151,C:316-335 |
| Q8E3E8 | DB14128 | NAD | 4qx6 | e4qx6D1 | D:152-315 |
| Q8E3E8 | DB14128 | NAD | 4qx6 | e4qx6D2 | D:-7-151,D:316-336 |
| Q8E3E8 | DB14128 | NAD | 5y37 | e5y37A1 | A:156-319 |
| Q8E3E8 | DB14128 | NAD | 5y37 | e5y37A2 | A:5-155,A:320-340 |
| Q8E3E8 | DB14128 | NAD | 5y37 | e5y37B1 | B:156-319 |
| Q8E3E8 | DB14128 | NAD | 5y37 | e5y37B2 | B:2-155,B:320-340 |
| Q8E3E8 | DB14128 | NAD | 5y37 | e5y37C2 | C:156-319 |
| Q8E3E8 | DB14128 | NAD | 5y37 | e5y37D1 | D:156-319 |