Attributes
UniProt ID
Protein Name
Tubulin
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2BTQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2btqA1e2btqA2e2btqB1e2btqB2
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8GCC5 | DB04315 | GDP | 2btq | e2btqA2 | A:3-246 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o091A1 | 1A:3-247 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o091A2 | 1A:248-435 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o092A1 | 2A:3-247 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o092A2 | 2A:248-435 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o093A1 | 3A:3-247 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o093A2 | 3A:248-435 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o094A1 | 4A:248-435 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o094A2 | 4A:3-247 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o095A1 | 5A:3-247 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o095A2 | 5A:248-435 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o096A1 | 6A:3-247 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o096A2 | 6A:248-435 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o097A1 | 7A:3-247 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o097A2 | 7A:248-435 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o098A1 | 8A:3-247 |
| Q8GCC5 | DB04315 | GDP | 5o09 | e5o098A2 | 8A:248-435 |