Attributes
UniProt ID
Protein Name
Flower-specific defensin
Ligand Name
1,2-DIOCTANOYL-SN-GLYCERO-3-PHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XYSBQYUENLDGMI-QGZVFWFLSA-M
SMILES
CCCCCCCC(=O)OCC(COP(=O)(O)[O-])OC(=O)CCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6B55
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6b55A1e6b55B1e6b55C1e6b55D1e6b55E1e6b55F1e6b55G1e6b55H1e6b55I1e6b55J1e6b55K1e6b55L1e6b55M1e6b55N1e6b55O1e6b55P1e6b55Q1e6b55R1e6b55S1e6b55T1
ECOD domains from experimental PDB structures interacting with ligand PA8
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55A1 | A:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55B1 | B:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55C1 | C:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55D1 | D:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55E1 | E:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55F1 | F:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55G1 | G:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55H1 | H:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55I1 | I:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55J1 | J:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55K1 | K:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55L1 | L:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55M1 | M:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55N1 | N:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55O1 | O:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55P1 | P:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55Q1 | Q:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55R1 | R:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55S1 | S:0-47 |
| Q8GTM0 | n/a | PA8 | 6b55 | e6b55T1 | T:0-47 |