Attributes
UniProt ID
Protein Name
Phenolic oxidative coupling protein
Ligand Name
8-ANILINO-1-NAPHTHALENE SULFONATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FWEOQOXTVHGIFQ-UHFFFAOYSA-N
SMILES
c1ccc(cc1)Nc2cccc3c2c(ccc3)S(=O)(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4N3E
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4n3eA1e4n3eB1e4n3eC1e4n3eD1e4n3eE1e4n3eF1e4n3eG1e4n3eH1e4n3eI1e4n3eJ1e4n3eK1e4n3eL1e4n3eM1e4n3eN1e4n3eO1e4n3eP1e4n3eQ1e4n3eR1e4n3eS1e4n3eT1e4n3eU1e4n3eV1e4n3eW1e4n3eX1e4n3eY1e4n3eZ1e4n3ea1e4n3eb1
ECOD domains from experimental PDB structures interacting with ligand DB04474
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eA1 | A:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eB1 | B:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eC1 | C:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eD1 | D:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eE1 | E:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eF1 | F:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eG1 | G:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eH1 | H:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eI1 | I:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eJ1 | J:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eK1 | K:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eL1 | L:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eM1 | M:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eN1 | N:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eO1 | O:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eP1 | P:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eQ1 | Q:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eR1 | R:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eS1 | S:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eU1 | U:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eV1 | V:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eW1 | W:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eX1 | X:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eY1 | Y:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eZ1 | Z:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3ea1 | a:1-159 |
| Q8H1L1 | DB04474 | 2AN | 4n3e | e4n3eb1 | b:1-159 |