Attributes
UniProt ID
Protein Name
Photosystem P840 reaction center, large subunit
Ligand Name
BACTERIOCHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DSJXIQQMORJERS-AGGZHOMASA-M
SMILES
CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6M32
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6m32A1e6m32A2e6m32B1e6m32E1e6m32F1e6m32G1e6m32a1e6m32a2
ECOD domains from experimental PDB structures interacting with ligand DB01853
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8KAY0 | DB01853 | BCL | 6m32 | e6m32A1 | A:406-708 |
| Q8KAY0 | DB01853 | BCL | 6m32 | e6m32A2 | A:59-405 |
| Q8KAY0 | DB01853 | BCL | 6m32 | e6m32a1 | a:406-708 |
| Q8KAY0 | DB01853 | BCL | 6m32 | e6m32a2 | a:59-405 |
| Q8KAY0 | DB01853 | BCL | 7uea | e7ueaA1 | A:58-405 |
| Q8KAY0 | DB01853 | BCL | 7uea | e7ueaA2 | A:406-709 |
| Q8KAY0 | DB01853 | BCL | 7uea | e7ueaa1 | a:59-405 |
| Q8KAY0 | DB01853 | BCL | 7uea | e7ueaa2 | a:406-708 |
| Q8KAY0 | DB01853 | BCL | 7ueb | e7uebA1 | A:59-405 |
| Q8KAY0 | DB01853 | BCL | 7ueb | e7uebA2 | A:406-708 |
| Q8KAY0 | DB01853 | BCL | 7ueb | e7ueba1 | a:57-405 |
| Q8KAY0 | DB01853 | BCL | 7ueb | e7ueba2 | a:406-708 |
| Q8KAY0 | DB01853 | BCL | 7z6q | e7z6qA1 | A:42-405 |
| Q8KAY0 | DB01853 | BCL | 7z6q | e7z6qA2 | A:406-708 |
| Q8KAY0 | DB01853 | BCL | 7z6q | e7z6qa1 | a:55-405 |
| Q8KAY0 | DB01853 | BCL | 7z6q | e7z6qa2 | a:406-708 |
| Q8KAY0 | DB01853 | BCL | 8gwa | e8gwaA1 | A:42-405 |
| Q8KAY0 | DB01853 | BCL | 8gwa | e8gwaA2 | A:406-708 |
| Q8KAY0 | DB01853 | BCL | 8gwa | e8gwaa1 | a:47-405 |
| Q8KAY0 | DB01853 | BCL | 8gwa | e8gwaa2 | a:406-708 |