Attributes
UniProt ID
Protein Name
UDP-glucuronic acid decarboxylase 1
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2B69
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2b69A1
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8NBZ7 | DB14128 | NAD | 2b69 | e2b69A1 | A:4-315 |
| Q8NBZ7 | DB14128 | NAD | 4gll | e4gllA1 | A:88-394 |
| Q8NBZ7 | DB14128 | NAD | 4gll | e4gllB1 | B:84-390 |
| Q8NBZ7 | DB14128 | NAD | 4lk3 | e4lk3A1 | A:88-206,A:233-399 |
| Q8NBZ7 | DB14128 | NAD | 4lk3 | e4lk3B1 | B:88-206,B:233-399 |
| Q8NBZ7 | DB14128 | NAD | 4lk3 | e4lk3C1 | C:88-206,C:233-399 |
| Q8NBZ7 | DB14128 | NAD | 4lk3 | e4lk3D1 | D:88-206,D:233-399 |
| Q8NBZ7 | DB14128 | NAD | 4lk3 | e4lk3E1 | E:88-206,E:233-399 |
| Q8NBZ7 | DB14128 | NAD | 4lk3 | e4lk3F1 | F:88-206,F:233-399 |
| Q8NBZ7 | DB14128 | NAD | 4m55 | e4m55A1 | A:88-206,A:234-399 |
| Q8NBZ7 | DB14128 | NAD | 4m55 | e4m55B1 | B:88-206,B:233-399 |
| Q8NBZ7 | DB14128 | NAD | 4m55 | e4m55C1 | C:88-206,C:233-399 |
| Q8NBZ7 | DB14128 | NAD | 4m55 | e4m55D1 | D:88-206,D:234-395 |
| Q8NBZ7 | DB14128 | NAD | 4m55 | e4m55E1 | E:90-203,E:237-262,E:300-323,E:364-371 |
| Q8NBZ7 | DB14128 | NAD | 4m55 | e4m55F2 | F:95-194,F:237-342,F:364-399 |