Attributes
UniProt ID
Protein Name
Pyrrolysine--tRNA ligase ligase
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2Q7G
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2q7gA1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8PWY1 | DB00171 | ATP | 2q7g | e2q7gA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 4tqd | e4tqdA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 4tqf | e4tqfA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 4zib | e4zibA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6aac | e6aacA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6aad | e6aadA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6aan | e6aanA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6aao | e6aaoA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6aap | e6aapA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6aaq | e6aaqA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6ab2 | e6ab2A1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6abl | e6ablA1 | A:188-454 |
| Q8PWY1 | DB00171 | ATP | 6abm | e6abmA1 | A:188-454 |