Attributes
UniProt ID
Protein Name
Glutamine synthetase
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8TFK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8tfkA1e8tfkA2e8tfkB1e8tfkB2e8tfkC1e8tfkC2e8tfkD1e8tfkD2e8tfkE1e8tfkE2e8tfkF1e8tfkF2e8tfkG1e8tfkG2e8tfkH1e8tfkH2e8tfkI1e8tfkI2e8tfkJ1e8tfkJ2e8tfkK1e8tfkK2e8tfkL1e8tfkL2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkA1 | A:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkA2 | A:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkB1 | B:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkB2 | B:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkC1 | C:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkC2 | C:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkD1 | D:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkD2 | D:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkE1 | E:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkE2 | E:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkF1 | F:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkF2 | F:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkG1 | G:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkG2 | G:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkH1 | H:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkH2 | H:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkI1 | I:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkI2 | I:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkJ1 | J:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkJ2 | J:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkK1 | K:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkK2 | K:104-447 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkL1 | L:8-103 |
| Q8PY99 | DB16833 | ADP | 8tfk | e8tfkL2 | L:104-447 |